kanishks207 kanishks207

19-01-2023
Social Studies

contestada

. Briefly explain the age, structure , density and composition of the population of India. class 8th long answer 80 to 120 words

Respuesta :

Otras preguntas

You should do all of the following to prepare for an extemporaneous speech, except: The answer is A. commit your speech to memory

Compare and contrast the Fahrenheit and Celsius temperature scales. Please write at least 3-4 sentences!!

Whoever does it I will Give a special thanks to them. Just answer 4.

How do I solve: 21 is 70% of ____

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

a group of 8 kids had 10 cookies how much cookies would they each get

I don't know if someone help

How can you reflect over X=Y

How did the aristocrats help the farmers in early china?

100 is 40% of what number?