20-04-2020
Mathematics

contestada

The growth/decay factor within the exponential equation y=4(5)x
is

Respuesta :

moyosoreoluwashodipo moyosoreoluwashodipo

20-04-2020

Answer:

hey...u boredd...u wanna chatt

Answer Link

shaleahbarrs4040 shaleahbarrs4040

13-05-2020

Answer: (0,4)

Step-by-step explanation:

Answer Link

Otras preguntas

Amos said, "I arrived before you."

nswer Draw and name the following compound CH3CHCHCH(CH3)CH(CH3)CH2CH2CH3 CECEC-

the cambrian explosion is a well-documented surge in diversity based on the extraordinary amount of fossil specimens. what factors contributed to this huge perc

Determine the enthalpy of reaction for HCI(g) + NaNO₂ (s) → HNO₂(1) + NaCl(s) 2NaCl(s) + H₂O(l) → 2HCI(g) + Na₂O(s) Hº = -507.1 kJ/mol NO(g) + NO₂(g) + Na₂O(s)

a block of mass m is on a rough horizontal surface and is attached to a spring with spring constant k. the coefficient of k. the coefficient of kinetic friction

A line passes through the point (-9,2) and has a slope of 4/3. Write an equation in point-slope form for this line.

Nutrition is an area that may be overlooked by some patients when dealing with their overall health and wellness. What are some things that you as a medical ass

A right circular cylinder has a base radius of 5 centimeters and a height of 12 centimeters. What is the volume of this cylinder? A. B. C. D.

PLEASE HELP thanks soooo much

Why would knowing the Pythagorean identity sin2x + cos2x = 1 and the sum identities allow you to prove all the other identities you have seen in this lesson?