aliceaaa1 aliceaaa1

16-11-2020
History

contestada

name two political differences between hamilton and thomas jefferson

Respuesta :

Аноним Аноним

16-11-2020

Answer:

Hamilton distrusted popular will and believed that the federal government should wield considerable power in order to steer a successful course, Jefferson placed his trust in the people as governors.

Explanation:

Answer Link

Otras preguntas

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

How much less than 3x2−7x+9 is 2x2+4x−8? What is the value of the result when x=2?

Based on a meta-analysis of almost 300 studies and about 20,000 participants by segerstrom & miller (2004), who is most likely to suffer the greatest suppre

Explain how structure of the intestinal lining enhances surface area

what is the difference of 3 times a number and 18 is 39. what is the number

Solve with distributive property, simplify 10 pts! Please help!

A simple exponential has the form y =bx explain how to determine what the graph would look like

Which social effects might an individual experience following a diagnosis with a sexually transmitted infection (STI)? Check all that apply.

An atp synthase is an enzyme that catalyzes formation of atp from adp and inorganic phosphate. under what conditions would you expect an atp synthase to catalyz

What was Thomas Jefferson afraid would happen if we could not buy the the area know as Louisiana