alexiajo2003
alexiajo2003 alexiajo2003
  • 17-11-2016
  • Social Studies
contestada

How do higher-level party leaders depend on precinct leaders?

Respuesta :

phannathan40343
phannathan40343 phannathan40343
  • 17-11-2016
Higher level party leaders need the precinct leader's support.
Answer Link

Otras preguntas

chlorofluorocarbons(CFCs) damage the ozone layer.Where do these chemicals come from?
A parabola is defined by the equation x = 5y2. In which direction will the parabola open? up down right left
what does sedentary lifestyle mean?
Why are junk bonds more popular during a bear market?
The implementation of judicial decisions is dependent upon ___________ because _________
help me please!! solve for j
What value of x makes the denominator of the function equal zero? y= 4/3x-33
A quadratic equation is shown below: 4x2 − 12x + 9 = 0 Part A: Describe the solution(s) to the equation by just determining the radicand. Show your work. (5 po
In the United States, culture varies based on all of the following factors EXCEPT: A.) ethnicity B.) talents C.) religion D.) education
The enzyme urease catalyzes this reaction. If urease is added to a solution that contains ammonia and other nitrogen-containing compounds (but no urea), will th