olaniyaneniolagrace olaniyaneniolagrace

20-03-2021
Business

contestada

Which of the following is not barrier to entrepreneurship ; lack of technical skills, political instability, technical knowledge, time pressure and distraction

Respuesta :

Bluemap Bluemap

20-03-2021

Answer:

Technical knowledge

Answer Link

Otras preguntas

The innermost meninx that protects the brain and spinal cord is the _________.

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

what is the sum of of each of the following series of numbers? 1+3+5+----+997+999

The photic zone extends to a depth of about_______

a used bookstore will trade two of its books for three of us and they'll brings and 18 books to trade how many books can she get from the store

List reasons why citizens may not be able to vote

Prepare the stockholders' equity section of upper a minus wirelessa−wireless's balance sheet at october 31, 2018. assume upper a minus wirelessa−wireless's n

What does the following algorithm do? public static void mystery(int nums[]) { for (int i = 0; i < nums.length; i++) { if (nums[i] % 2 != 0)

The big fis the moral component of personality that incorporates social standards about what represents right and wrong . aspects of the personality that serves

What is the first 5 terms of the sequence T(n) = 2n + 5