adairhernandez8 adairhernandez8

17-01-2018
Chemistry

contestada

What's the group and region of krypton? 20 points

Respuesta :

icedipping icedipping

17-01-2018

Krypton is group 8 (or 18 depending on your choice of convention) and period 4.

Not sure what you mean by region, it's not a chemistry term in the context you're presenting. If you're asking for what type of element it is, it's a noble gas.

Answer Link

Otras preguntas

Simplify the expression (x¹2)3.

debra purchased a prepaid phone card for $40.75. calls cost 25 cents a minute using this card. the credit, c (in dollars), left on the card after it is used for

suppose the age that children learn to walk is normally distributed with mean 11 months and standard deviation 2.3 month. 34 randomly selected people were asked

identify the groups in favor of abolition of slavery and those against

nswer Draw and name the following compound CH3CHCHCH(CH3)CH(CH3)CH2CH2CH3 CECEC-

the pax romana, which began when augustus took power, laster about 200 years true or false

When organisms die, the carbon they contain may be "locked-up" in fossil fuels. Which process must be avoided for this to happen?

Why does communication fail to occur in the majority of PowerPoint presentations? OA. The slides are so complex, detailed, abstract and wordy they are boring to

(Score for Question 5: of 15 points) 5. What five characters should be included in the game and why? You should name and describe each character and his or her

9. Waves originate from